|
CAS#: 22201-93-0 Product: 3-(4-Chloro-alpha-Phenylbenzyl)-1,4,5,6-Tetrahydro-1,2,4-Triazine No suppilers available for the product. |
| Name | 3-(4-Chloro-alpha-Phenylbenzyl)-1,4,5,6-Tetrahydro-1,2,4-Triazine |
|---|---|
| Synonyms | 3-[(4-Chlorophenyl)-Phenyl-Methyl]-1,2,5,6-Tetrahydro-1,2,4-Triazine; 1,4,5,6-Tetrahydro-3-(P-Chlorodiphenylmethyl)-As-Triazine; 3-(P-Chlorodiphenylmethyl)-1,4,5,6-Tetrahydro-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 |
| CAS Registry Number | 22201-93-0 |
| SMILES | C3=C(C(C1=NCCNN1)C2=CC=CC=C2)C=CC(=C3)Cl |
| InChI | 1S/C16H16ClN3/c17-14-8-6-13(7-9-14)15(12-4-2-1-3-5-12)16-18-10-11-19-20-16/h1-9,15,19H,10-11H2,(H,18,20) |
| InChIKey | CYVJNUPECIMGIT-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.61°C at 760 mmHg (Cal.) |
| Flash point | 216.04°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chloro-alpha-Phenylbenzyl)-1,4,5,6-Tetrahydro-1,2,4-Triazine |