|
CAS#: 22324-44-3 Product: Palustrine No suppilers available for the product. |
| Name | Palustrine |
|---|---|
| Synonyms | Palustrine; C10608 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 |
| CAS Registry Number | 22324-44-3 |
| SMILES | [C@@H]2(N1[C@@H](CC(=O)NCCCCNCCC1)C=CC2)[C@@H](O)CC |
| InChI | 1S/C17H31N3O2/c1-2-16(21)15-8-5-7-14-13-17(22)19-11-4-3-9-18-10-6-12-20(14)15/h5,7,14-16,18,21H,2-4,6,8-13H2,1H3,(H,19,22)/t14-,15+,16+/m1/s1 |
| InChIKey | YBZUGUWOQLUNKD-PMPSAXMXSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.299°C at 760 mmHg (Cal.) |
| Flash point | 265.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Palustrine |