|
CAS#: 22330-42-3 Product: 6,7-Dimethoxy-2-Methyl-1H-Benz[de]Isoquinoline-1,3(2H)-Dione No suppilers available for the product. |
| Name | 6,7-Dimethoxy-2-Methyl-1H-Benz[de]Isoquinoline-1,3(2H)-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 |
| CAS Registry Number | 22330-42-3 |
| EINECS | 244-915-5 |
| SMILES | C1=CC(=C3C2=C1C(N(C(C2=CC=C3OC)=O)C)=O)OC |
| InChI | 1S/C15H13NO4/c1-16-14(17)8-4-6-10(19-2)13-11(20-3)7-5-9(12(8)13)15(16)18/h4-7H,1-3H3 |
| InChIKey | GWQIRICPSOISHC-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.207°C at 760 mmHg (Cal.) |
| Flash point | 240.592°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethoxy-2-Methyl-1H-Benz[de]Isoquinoline-1,3(2H)-Dione |