|
CAS#: 22485-08-1 Product: 1,3,4,14b-Tetrahydro-2,7-Dimethyl-2H-Dibenzo[b,f]Pyrazino[1,2-d][1,4]Oxazepine No suppilers available for the product. |
| Name | 1,3,4,14b-Tetrahydro-2,7-Dimethyl-2H-Dibenzo[b,f]Pyrazino[1,2-d][1,4]Oxazepine |
|---|---|
| Synonyms | Pdsp1_001079; Pdsp2_001063 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 |
| CAS Registry Number | 22485-08-1 |
| EINECS | 245-031-2 |
| SMILES | C1=C(C=CC2=C1N4C(C3=C(O2)C=CC=C3)CN(CC4)C)C |
| InChI | 1S/C18H20N2O/c1-13-7-8-18-15(11-13)20-10-9-19(2)12-16(20)14-5-3-4-6-17(14)21-18/h3-8,11,16H,9-10,12H2,1-2H3 |
| InChIKey | AQCUOHAOVDYWGZ-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.156°C at 760 mmHg (Cal.) |
| Flash point | 123.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,14b-Tetrahydro-2,7-Dimethyl-2H-Dibenzo[b,f]Pyrazino[1,2-d][1,4]Oxazepine |