Online Database of Chemicals from Around the World
|
CAS#: 22494-27-5 Product: Flufenisal No suppilers available for the product. |
| Name | Flufenisal |
|---|---|
| Synonyms | 2-Acetoxy-5-(4-Fluorophenyl)Benzoic Acid; D04206; Flufenisal (Usan) |
| Molecular Structure |  |
| Molecular Formula | C15H11FO4 |
| Molecular Weight | 274.25 |
| CAS Registry Number | 22494-27-5 |
| SMILES | C1=C(C(=CC=C1C2=CC=C(F)C=C2)OC(C)=O)C(O)=O |
| InChI | 1S/C15H11FO4/c1-9(17)20-14-7-4-11(8-13(14)15(18)19)10-2-5-12(16)6-3-10/h2-8H,1H3,(H,18,19) |
| InChIKey | XKSAJZSJKURQRX-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.376°C at 760 mmHg (Cal.) |
| Flash point | 218.318°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Flufenisal |