|
CAS#: 22506-55-4 Product: 2,3-Dimethoxyanthraquinone No suppilers available for the product. |
| Name | 2,3-Dimethoxyanthraquinone |
|---|---|
| Synonyms | 2,3-Dimethoxy-9,10-Anthraquinone; 9,10-Anthracenedione, 2,3-Dimethoxy-; Nsc126879 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 22506-55-4 |
| SMILES | C1=C(OC)C(=CC2=C1C(=O)C3=C(C2=O)C=CC=C3)OC |
| InChI | 1S/C16H12O4/c1-19-13-7-11-12(8-14(13)20-2)16(18)10-6-4-3-5-9(10)15(11)17/h3-8H,1-2H3 |
| InChIKey | SSSUEMJDMRBPMY-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.087°C at 760 mmHg (Cal.) |
| Flash point | 207.91°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethoxyanthraquinone |