|
CAS#: 22522-32-3 Product: Butan-2-Yloxy-Methyl-Propan-2-Yloxy-Sulfanylidenephosphorane No suppilers available for the product. |
| Name | Butan-2-Yloxy-Methyl-Propan-2-Yloxy-Sulfanylidenephosphorane |
|---|---|
| Synonyms | Isopropoxy-Methyl-Sec-Butoxy-Thioxo-Phosphorane; Isopropoxy-Methyl-Sec-Butoxy-Thioxophosphorane; Butan-2-Yloxy-Methyl-Propan-2-Yloxy-Sulfanylidene-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19O2PS |
| Molecular Weight | 210.27 |
| CAS Registry Number | 22522-32-3 |
| SMILES | C(C(O[P](C)(OC(C)C)=S)C)C |
| InChI | 1S/C8H19O2PS/c1-6-8(4)10-11(5,12)9-7(2)3/h7-8H,6H2,1-5H3 |
| InChIKey | RHIVCZKNSMCBNC-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.415°C at 760 mmHg (Cal.) |
| Flash point | 90.733°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butan-2-Yloxy-Methyl-Propan-2-Yloxy-Sulfanylidenephosphorane |