|
CAS#: 22532-47-4 Product: 2-(4-Methylphenyl)Ethyl Acetate No suppilers available for the product. |
| Name | 2-(4-Methylphenyl)Ethyl Acetate |
|---|---|
| Synonyms | Acetic Acid 2-(4-Methylphenyl)Ethyl Ester; 2-(4-Methylphenyl)Ethyl Ethanoate; Para-Cresyl Ethylacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 22532-47-4 |
| EINECS | 245-056-9 |
| SMILES | C1=C(C=CC(=C1)C)CCOC(=O)C |
| InChI | 1S/C11H14O2/c1-9-3-5-11(6-4-9)7-8-13-10(2)12/h3-6H,7-8H2,1-2H3 |
| InChIKey | SQLIRIQAWQKBFY-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methylphenyl)Ethyl Acetate |