|
CAS#: 2253-52-3 Product: Bis(2-Methylpropoxy)-Sulfanyl-Sulfanylidenephosphorane No suppilers available for the product. |
| Name | Bis(2-Methylpropoxy)-Sulfanyl-Sulfanylidenephosphorane |
|---|---|
| Synonyms | Diisobutoxy-Sulfanyl-Thioxo-Phosphorane; Diisobutoxy-Mercapto-Thioxophosphorane; Diisobutoxy-Mercapto-Thioxo-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19O2PS2 |
| Molecular Weight | 242.33 |
| CAS Registry Number | 2253-52-3 |
| EINECS | 218-849-2 |
| SMILES | C(O[P](OCC(C)C)(S)=S)C(C)C |
| InChI | 1S/C8H19O2PS2/c1-7(2)5-9-11(12,13)10-6-8(3)4/h7-8H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | SYFIMIPHNTZHIN-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.772°C at 760 mmHg (Cal.) |
| Flash point | 130.864°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Methylpropoxy)-Sulfanyl-Sulfanylidenephosphorane |