|
CAS#: 22606-89-9 Product: 1-Benzyl-2,2-Dimethyl-3-(2-Methyl-2-Propanyl)Azetidine No suppilers available for the product. |
| Name | 1-Benzyl-2,2-Dimethyl-3-(2-Methyl-2-Propanyl)Azetidine |
|---|---|
| Synonyms | 1-Benzyl-3-tert-butyl-2,2-dimethylazetidine # |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 |
| CAS Registry Number | 22606-89-9 |
| SMILES | c1ccc(cc1)CN2C(C(C2)C(C)(C)C)(C)C |
| InChI | 1S/C16H25N/c1-15(2,3)14-12-17(16(14,4)5)11-13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3 |
| InChIKey | FMCVPLJPSGGKLH-UHFFFAOYSA-N |
| Density | 0.944g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.479°C at 760 mmHg (Cal.) |
| Flash point | 113.356°C (Cal.) |
| Refractive index | 1.517 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-2,2-Dimethyl-3-(2-Methyl-2-Propanyl)Azetidine |