|
CAS#: 22618-51-5 Product: Cyclohexen-1-Yltoluene No suppilers available for the product. |
| Name | Cyclohexen-1-Yltoluene |
|---|---|
| Synonyms | 1-(1-Cyclohexenyl)-2-Methyl-Benzene; Benzene, 1-(1-Cyclohexen-1-Yl)-2-Methyl-; Nsc102328 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 22618-51-5 |
| EINECS | 245-131-6 |
| SMILES | C2=C(C1=CCCCC1)C(=CC=C2)C |
| InChI | 1S/C13H16/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12/h5-8,10H,2-4,9H2,1H3 |
| InChIKey | CVNBWDMYHUGFDG-UHFFFAOYSA-N |
| Density | 0.967g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.732°C at 760 mmHg (Cal.) |
| Flash point | 111.568°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Cyclohexen-1-Yltoluene |