Online Database of Chemicals from Around the World
|
CAS#: 22619-36-9 Product: (E)-1-(4-Chlorophenyl)-3-[5-Chloro-2-(2-Thienyl)Phenyl]Prop-2-En-1-One No suppilers available for the product. |
| Name | (E)-1-(4-Chlorophenyl)-3-[5-Chloro-2-(2-Thienyl)Phenyl]Prop-2-En-1-One |
|---|---|
| Synonyms | 4',5-dichloro-2-thienylchalcone |
| Molecular Structure | ![CAS#: 22619-36-9, (E)-1-(4-Chlorophenyl)-3-[5-Chloro-2-(2-Thienyl)Phenyl]Prop-2-En-1-One](/moreStructures/22619-36-9.gif) |
| Molecular Formula | C19H12Cl2OS |
| Molecular Weight | 359.27 |
| CAS Registry Number | 22619-36-9 |
| EINECS | 245-133-7 |
| SMILES | Clc1ccc(cc1)C(=O)/C=C/c2cc(Cl)ccc2c3cccs3 |
| InChI | 1S/C19H12Cl2OS/c20-15-6-3-13(4-7-15)18(22)10-5-14-12-16(21)8-9-17(14)19-2-1-11-23-19/h1-12H/b10-5+ |
| InChIKey | PYNRSLVTMKQZAW-BJMVGYQFSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.961°C at 760 mmHg (Cal.) |
| Flash point | 271.891°C (Cal.) |
| Refractive index | 1.666 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1-(4-Chlorophenyl)-3-[5-Chloro-2-(2-Thienyl)Phenyl]Prop-2-En-1-One |