|
CAS#: 22699-97-4 Product: (3,4-Dimethoxyphenyl)(3,4,5-Trimethoxyphenyl)-Methanone No suppilers available for the product. |
| Name | (3,4-Dimethoxyphenyl)(3,4,5-Trimethoxyphenyl)-Methanone |
|---|---|
| Synonyms | Benzophenone, 3,3',4,4',5-Pentamethoxy-; Methanone, (3,4-Dimethoxyphenyl)(3,4,5-Trimethoxyphenyl)-; Nsc81274 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 |
| CAS Registry Number | 22699-97-4 |
| SMILES | C1=C(C(=C(C=C1C(C2=CC(=C(C=C2)OC)OC)=O)OC)OC)OC |
| InChI | 1S/C18H20O6/c1-20-13-7-6-11(8-14(13)21-2)17(19)12-9-15(22-3)18(24-5)16(10-12)23-4/h6-10H,1-5H3 |
| InChIKey | LEGVQFQAMCUMQW-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.262°C at 760 mmHg (Cal.) |
| Flash point | 216.111°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3,4-Dimethoxyphenyl)(3,4,5-Trimethoxyphenyl)-Methanone |