Online Database of Chemicals from Around the World
|
CAS#: 22712-32-9 Product: 3,8,10-Trimethyl-2,3,5,8,10-Pentazabicyclo[4.4.0]Deca-1,5-Diene-4,7,9-Trione No suppilers available for the product. |
| Name | 3,8,10-Trimethyl-2,3,5,8,10-Pentazabicyclo[4.4.0]Deca-1,5-Diene-4,7,9-Trione |
|---|---|
| Synonyms | 2,8-Dihydro-2,6,8-Trimethylpyrimido(5,4-E)-As-Triazine-3,5,7-Trione; 2-Methylfervenulone; Brn 0540815 |
| Molecular Structure | ![CAS#: 22712-32-9, 3,8,10-Trimethyl-2,3,5,8,10-Pentazabicyclo[4.4.0]Deca-1,5-Diene-4,7,9-Trione](/moreStructures/22712-32-9.gif) |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.19 |
| CAS Registry Number | 22712-32-9 |
| SMILES | CN2C1=NN(C(=O)N=C1C(=O)N(C2=O)C)C |
| InChI | 1S/C8H9N5O3/c1-11-5-4(6(14)12(2)8(11)16)9-7(15)13(3)10-5/h1-3H3 |
| InChIKey | NLCDJWLDGSBUOQ-UHFFFAOYSA-N |
| Density | 1.648g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.628°C at 760 mmHg (Cal.) |
| Flash point | 134.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,8,10-Trimethyl-2,3,5,8,10-Pentazabicyclo[4.4.0]Deca-1,5-Diene-4,7,9-Trione |