|
CAS#: 22719-81-9 Product: Ethyl p-Tolyl Carbonate No suppilers available for the product. |
| Name | Ethyl p-Tolyl Carbonate |
|---|---|
| Synonyms | Carbonic Acid Ethyl (4-Methylphenyl) Ester; Nsc9016; P-Tolyl Ethyl Carbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 22719-81-9 |
| EINECS | 245-175-6 |
| SMILES | C1=C(C=CC(=C1)OC(=O)OCC)C |
| InChI | 1S/C10H12O3/c1-3-12-10(11)13-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
| InChIKey | SMZZUTOGLVAUKB-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.369°C at 760 mmHg (Cal.) |
| Flash point | 104.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl p-Tolyl Carbonate |