|
CAS#: 22796-70-9 Product: 5-Butyl-1-Methyl-2-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 5-Butyl-1-Methyl-2-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 5-Butyl-1-Methyl-2-Nitro-Imidazole; Imidazole, 5-Butyl-1-Methyl-2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 |
| CAS Registry Number | 22796-70-9 |
| SMILES | C1=C(CCCC)[N](C(=N1)[N+]([O-])=O)C |
| InChI | 1S/C8H13N3O2/c1-3-4-5-7-6-9-8(10(7)2)11(12)13/h6H,3-5H2,1-2H3 |
| InChIKey | YGRSFVUXNRPCJA-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.227°C at 760 mmHg (Cal.) |
| Flash point | 158.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Butyl-1-Methyl-2-Nitro-1H-Imidazole |