|
CAS#: 22824-32-4 Product: 1,2,3,4-Tetrahydro-1,4,6-Trimethylnaphthalene No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydro-1,4,6-Trimethylnaphthalene |
|---|---|
| Synonyms | 1,4,6-Trimethyltetralin; Naphthalene, 1,2,3,4-Tetrahydro-1,4,6-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 |
| CAS Registry Number | 22824-32-4 |
| SMILES | C1=C2C(=CC(=C1)C)C(C)CCC2C |
| InChI | 1S/C13H18/c1-9-4-7-12-10(2)5-6-11(3)13(12)8-9/h4,7-8,10-11H,5-6H2,1-3H3 |
| InChIKey | HIACZWPSGFMDRF-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.52°C at 760 mmHg (Cal.) |
| Flash point | 107.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-1,4,6-Trimethylnaphthalene |