Online Database of Chemicals from Around the World
|
CAS#: 22916-22-9 Product: 2-(Trichloromethyl)-Thiazolidine hydrochloride No suppilers available for the product. |
| Name | 2-(Trichloromethyl)-Thiazolidine hydrochloride |
|---|---|
| Synonyms | 2-(Trichloromethyl)Thiazolidine Hydrochloride; 2-Trichloromethylthiazolidine Hydrochloride; Thiazolidine, 2-Trichloromethyl-, Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C4H7Cl4NS |
| Molecular Weight | 242.98 |
| CAS Registry Number | 22916-22-9 |
| SMILES | [H+].C1SC(NC1)C(Cl)(Cl)Cl.[Cl-] |
| InChI | 1S/C4H6Cl3NS.ClH/c5-4(6,7)3-8-1-2-9-3;/h3,8H,1-2H2;1H |
| InChIKey | BLQZSHLYXCKZLU-UHFFFAOYSA-N |
| Boiling point | 283.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 125.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Trichloromethyl)-Thiazolidine hydrochloride |