|
CAS#: 23019-43-4 Product: 3-(4-Bromophenyl)-4-Ethoxy-Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 3-(4-Bromophenyl)-4-Ethoxy-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 3-(4-Bromophenyl)-4-Ethoxy-Pyrrole-2,5-Dione; 3-(4-Bromophenyl)-4-Ethoxy-3-Pyrroline-2,5-Quinone; Nciopen2_005090 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 |
| CAS Registry Number | 23019-43-4 |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)NC2=O)OCC)Br |
| InChI | 1S/C12H10BrNO3/c1-2-17-10-9(11(15)14-12(10)16)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H,14,15,16) |
| InChIKey | WJIXMAZAUWXCNA-UHFFFAOYSA-N |
| Density | 1.609g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.575°C at 760 mmHg (Cal.) |
| Flash point | 225.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Bromophenyl)-4-Ethoxy-Pyrrole-2,5-Dione |