|
CAS#: 23044-69-1 Product: (3E)-2,4-Diphenyl-3-Butenoic Acid No suppilers available for the product. |
| Name | (3E)-2,4-Diphenyl-3-Butenoic Acid |
|---|---|
| Synonyms | 2,4-DIPHENYLBUT-3-ENOIC ACID; NSC154652 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28 |
| CAS Registry Number | 23044-69-1 |
| SMILES | C1=CC=C(C=C1)/C=C/C(C2=CC=CC=C2)C(=O)O |
| InChI | 1S/C16H14O2/c17-16(18)15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12,15H,(H,17,18)/b12-11+ |
| InChIKey | XDCWKTVDGLXVME-VAWYXSNFSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.6±11.0°C at 760 mmHg (Cal.) |
| Flash point | 291.4±14.4°C (Cal.) |
| Refractive index | 1.637 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3E)-2,4-Diphenyl-3-Butenoic Acid |