|
CAS#: 23101-98-6 Product: 1-Bromo-3-Methyl-3-Nitrobutane No suppilers available for the product. |
| Name | 1-Bromo-3-Methyl-3-Nitrobutane |
|---|---|
| Synonyms | 1-Bromo-3-Methyl-3-Nitro-Butane; Butane, 1-Bromo-3-Methyl-3-Nitro-; Nsc116812 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10BrNO2 |
| Molecular Weight | 196.04 |
| CAS Registry Number | 23101-98-6 |
| SMILES | C(Br)CC([N+]([O-])=O)(C)C |
| InChI | 1S/C5H10BrNO2/c1-5(2,3-4-6)7(8)9/h3-4H2,1-2H3 |
| InChIKey | BGSYPAWCMYERMA-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 217.884°C at 760 mmHg (Cal.) |
| Flash point | 85.574°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-3-Methyl-3-Nitrobutane |