|
CAS#: 23167-96-6 Product: Potassium glucoheptonate No suppilers available for the product. |
| Name | Potassium glucoheptonate |
|---|---|
| Synonyms | Potassium (2S,3S,4R,5S,6S)-2,3,4,5,6,7-Hexahydroxyenanthic Acid; (2.Xi.)-D-Gluco-Heptonic Acid, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14KO8 |
| Molecular Weight | 265.28 |
| CAS Registry Number | 23167-96-6 |
| EINECS | 245-473-6 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)C(O)=O)[C@@H](O)[C@@H](O)CO.[K+] |
| InChI | 1S/C7H14O8.K/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2-6,8-13H,1H2,(H,14,15);/q;+1/t2-,3-,4+,5-,6-;/m0./s1 |
| InChIKey | ORUCCVLWOQSRMC-SMESVBAVSA-N |
| Boiling point | 727.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 407.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium glucoheptonate |