|
CAS#: 2319-97-3 Product: Tricyclo[9.3.1.14,8]hexadeca-1(15),4,6,8(16),11,13-hexaene No suppilers available for the product. |
| Name | Tricyclo[9.3.1.14,8]hexadeca-1(15),4,6,8(16),11,13-hexaene |
|---|---|
| Synonyms | Di-1,3-Xylylene; Di-M-Xylylene; Nsc106252 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 2319-97-3 |
| SMILES | C3=C2C=C(CCC1=CC(=CC=C1)CC2)C=C3 |
| InChI | 1S/C16H16/c1-3-13-7-9-15-5-2-6-16(12-15)10-8-14(4-1)11-13/h1-6,11-12H,7-10H2 |
| InChIKey | COTONUHLIMVDNV-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.999°C at 760 mmHg (Cal.) |
| Flash point | 151.9±14.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tricyclo[9.3.1.14,8]hexadeca-1(15),4,6,8(16),11,13-hexaene |