Online Database of Chemicals from Around the World
|
CAS#: 23248-53-5 Product: Bis(1,2-Dichlorovinyl) Sulfoxide No suppilers available for the product. |
| Name | Bis(1,2-Dichlorovinyl) Sulfoxide |
|---|---|
| Synonyms | 1,2-Dichloro-1-(1,2-Dichloroethenylsulfinyl)Ethene; (Z)-1,2-Dichloro-1-[(Z)-1,2-Dichlorovinyl]Sulfinyl-Ethylene; 1,2-Dichloro-1-(1,2-Dichlorovinylsulfinyl)Ethylene |
| Molecular Structure |  |
| Molecular Formula | C4H2Cl4OS |
| Molecular Weight | 239.93 |
| CAS Registry Number | 23248-53-5 |
| SMILES | O=[S](C(/Cl)=C/Cl)C(/Cl)=C/Cl |
| InChI | 1S/C4H2Cl4OS/c5-1-3(7)10(9)4(8)2-6/h1-2H/b3-1+,4-2+ |
| InChIKey | QRJJBBCDCLDZOO-ZPUQHVIOSA-N |
| Density | 1.759g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.861°C at 760 mmHg (Cal.) |
| Flash point | 156.319°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1,2-Dichlorovinyl) Sulfoxide |