| Name | Propa-1,2-Dienylbenzene |
|---|---|
| Synonyms | Inchi=1/C9h8/C1-2-6-9-7-4-3-5-8-9/H3-8H,1H; Propa-1,2-Dien-1-Ylbenzene; Benzene, Propadienyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8 |
| Molecular Weight | 116.16 |
| CAS Registry Number | 2327-99-3 |
| SMILES | C1=C([CH]=[C]=[CH2])C=CC=C1 |
| InChI | 1S/C9H8/c1-2-6-9-7-4-3-5-8-9/h3-8H,1H2 |
| InChIKey | WEHMXWJFCCNXHJ-UHFFFAOYSA-N |
| Density | 0.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.668°C at 760 mmHg (Cal.) |
| Flash point | 64.262°C (Cal.) |
| (1) | Ji Hoon Park, Eunha Kim, Hyeong-Mook Kim, Soo Young Choi and Young Keun Chung. Cobalt/rhodium heterobimetallic nanoparticle-catalyzed carbonylative [2+2+1] cycloaddition of allenes and bisallenes to Pauson–Khand-type reaction products, Chem. Commun., 2008, 2388. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Propa-1,2-Dienylbenzene |