|
CAS#: 23284-25-5 Product: Bupranolol No suppilers available for the product. |
| Name | Bupranolol |
|---|---|
| Synonyms | 1-(Tert-Butylamino)-3-(2-Chloro-5-Methyl-Phenoxy)Propan-2-Ol Hydrochloride; 3-(Tert-Butylamino)-1-((6-Chloro-M-Tolyl)Oxy)Propan-2-Ol Hydrochloride; B 1312 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23Cl2NO2 |
| Molecular Weight | 308.25 |
| CAS Registry Number | 23284-25-5 |
| SMILES | [H+].C1=C(C=CC(=C1OCC(O)CNC(C)(C)C)Cl)C.[Cl-] |
| InChI | 1S/C14H22ClNO2.ClH/c1-10-5-6-12(15)13(7-10)18-9-11(17)8-16-14(2,3)4;/h5-7,11,16-17H,8-9H2,1-4H3;1H |
| InChIKey | WJUUZHQWGKSLIJ-UHFFFAOYSA-N |
| Boiling point | 396.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 193.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bupranolol |