|
CAS#: 234-41-3 Product: Benzo[g][1]Benzothiole No suppilers available for the product. |
| Name | Benzo[g][1]Benzothiole |
|---|---|
| Synonyms | Benzo[G]Benzothiophene; 6,7-Benzothionaphthene; Brn 0120792 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8S |
| Molecular Weight | 184.26 |
| CAS Registry Number | 234-41-3 |
| EINECS | 205-941-2 |
| SMILES | C2=CC1=CC=C3C(=C1S2)C=CC=C3 |
| InChI | 1S/C12H8S/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11/h1-8H |
| InChIKey | XHYRHAQEXJIVJX-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.16°C at 760 mmHg (Cal.) |
| Flash point | 118.434°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[g][1]Benzothiole |