|
CAS#: 23417-34-7 Product: 2-(2-Methylphenylimino)Oxazolidine No suppilers available for the product. |
| Name | 2-(2-Methylphenylimino)Oxazolidine |
|---|---|
| Synonyms | N-(2-Methylphenyl)-4,5-Dihydrooxazol-2-Amine; 4,5-Dihydrooxazol-2-Yl-(2-Methylphenyl)Amine; 4,5-Dihydro-2-(O-Methylphenylamino)Oxazole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 |
| CAS Registry Number | 23417-34-7 |
| SMILES | C1=C(C(=CC=C1)NC2=NCCO2)C |
| InChI | 1S/C10H12N2O/c1-8-4-2-3-5-9(8)12-10-11-6-7-13-10/h2-5H,6-7H2,1H3,(H,11,12) |
| InChIKey | QLOGFFCTOGPFIU-UHFFFAOYSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.846°C at 760 mmHg (Cal.) |
| Flash point | 111.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methylphenylimino)Oxazolidine |