|
CAS#: 2354-06-5 Product: 1,1,1,3,3-Pentachloro-2,2,3-Trifluoropropane No suppilers available for the product. |
| Name | 1,1,1,3,3-Pentachloro-2,2,3-Trifluoropropane |
|---|---|
| Synonyms | 1,1,1,3,3-Pentachloro-2,2,3-Trifluoro-Propane; 1,2,2-Trifluoropentachloropropane; Nsc516388 |
| Molecular Structure | ![]() |
| Molecular Formula | C3Cl5F3 |
| Molecular Weight | 270.29 |
| CAS Registry Number | 2354-06-5 |
| SMILES | ClC(C(F)(C(Cl)(Cl)Cl)F)(F)Cl |
| InChI | 1S/C3Cl5F3/c4-2(5,6)1(9,10)3(7,8)11 |
| InChIKey | HEZMYTBCTJCBQB-UHFFFAOYSA-N |
| Density | 1.784g/cm3 (Cal.) |
|---|---|
| Boiling point | 148.143°C at 760 mmHg (Cal.) |
| Flash point | 54.463°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,3-Pentachloro-2,2,3-Trifluoropropane |