|
CAS#: 23557-79-1 Product: N-(3-Chloro-p-Tolyl)Benzamidine No suppilers available for the product. |
| Name | N-(3-Chloro-p-Tolyl)Benzamidine |
|---|---|
| Synonyms | N'-(3-Chloro-4-Methyl-Phenyl)Benzamidine; N'-(3-Chloro-4-Methylphenyl)Benzamidine; N'-(3-Chloro-4-Methyl-Phenyl)Benzenecarboximidamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 |
| CAS Registry Number | 23557-79-1 |
| SMILES | C1=CC(=CC(=C1C)Cl)N=C(N)C2=CC=CC=C2 |
| InChI | 1S/C14H13ClN2/c1-10-7-8-12(9-13(10)15)17-14(16)11-5-3-2-4-6-11/h2-9H,1H3,(H2,16,17) |
| InChIKey | RRAAXVNDOQYYAW-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.407°C at 760 mmHg (Cal.) |
| Flash point | 201.402°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Chloro-p-Tolyl)Benzamidine |