|
CAS#: 23567-85-3 Product: Monoferric Phytate No suppilers available for the product. |
| Name | Monoferric Phytate |
|---|---|
| Synonyms | Ferric (2,3,4,5,6-Pentaphosphonooxycyclohexyl) Dihydrogen Phosphate; Fe-Insp6; Ferric Myo-Inositol Hexakisphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H18FeO24P6 |
| Molecular Weight | 715.88 |
| CAS Registry Number | 23567-85-3 |
| SMILES | O=[P](OC1C(O[P](O)(O)=O)C(O[P](O)(O)=O)C(O[P](O)(O)=O)C(O[P](O)(O)=O)C1O[P](O)(O)=O)(O)O.[Fe+3] |
| InChI | 1S/C6H18O24P6.Fe/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15;/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);/q;+3 |
| InChIKey | RRALFRRRKZGFRV-UHFFFAOYSA-N |
| Boiling point | 1190.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 673.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Monoferric Phytate |