|
CAS#: 23695-63-8 Product: 4a,8alpha-(Methanothiomethano)Naphthalene 10,10-Dioxide No suppilers available for the product. |
| Name | 4a,8alpha-(Methanothiomethano)Naphthalene 10,10-Dioxide |
|---|---|
| Synonyms | St5441167; 4.Alpha.,8.Alpha.-(Methanothiomethano)Naphthalene-10,10-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 |
| CAS Registry Number | 23695-63-8 |
| SMILES | O=[S]1(=O)CC23C(C1)(C=CC=C2)C=CC=C3 |
| InChI | 1S/C12H12O2S/c13-15(14)9-11-5-1-2-6-12(11,10-15)8-4-3-7-11/h1-8H,9-10H2 |
| InChIKey | GJZLCJJIQHGLOB-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.774°C at 760 mmHg (Cal.) |
| Flash point | 321.338°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4a,8alpha-(Methanothiomethano)Naphthalene 10,10-Dioxide |