|
CAS#: 23819-11-6 Product: N-Ethylethanaminium (2,4,5-Trichlorophenoxy)Acetate No suppilers available for the product. |
| Name | N-Ethylethanaminium (2,4,5-Trichlorophenoxy)Acetate |
|---|---|
| Synonyms | diethylammonium (2,4,5-trichlorophenoxy)acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16Cl3NO3 |
| Molecular Weight | 328.62 |
| CAS Registry Number | 23819-11-6 |
| EINECS | 245-897-1 |
| SMILES | Clc1cc(OCC([O-])=O)c(Cl)cc1Cl.CC[NH2+]CC |
| InChI | 1S/C8H5Cl3O3.C4H11N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-3-5-4-2/h1-2H,3H2,(H,12,13);5H,3-4H2,1-2H3 |
| InChIKey | CFIABBBIDUBPQY-UHFFFAOYSA-N |
| Boiling point | 428.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 213.2°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethylethanaminium (2,4,5-Trichlorophenoxy)Acetate |