| Name | 2,3-Dimethylbutane-1,2,3-Tricarboxylic Acid |
|---|---|
| Synonyms | (-)-2,3-Dimethylbutane-1,2,3-Tricarboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 2385-74-2 |
| EINECS | 219-192-4 |
| SMILES | C(C(C(=O)O)(C(C(=O)O)(C)C)C)C(=O)O |
| InChI | 1S/C9H14O6/c1-8(2,6(12)13)9(3,7(14)15)4-5(10)11/h4H2,1-3H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | MJCJFUJXVGIUOD-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.49°C at 760 mmHg (Cal.) |
| Flash point | 144.323°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethylbutane-1,2,3-Tricarboxylic Acid |