|
CAS#: 2388-04-7 Product: 1-Ethyl-2,3,4,5,6-Pentamethylbenzene No suppilers available for the product. |
| Name | 1-Ethyl-2,3,4,5,6-Pentamethylbenzene |
|---|---|
| Synonyms | 1-Ethyl-2,3,4,5,6-pentamethylbenzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 |
| CAS Registry Number | 2388-04-7 |
| SMILES | c1(c(c(c(c(c1CC)C)C)C)C)C |
| InChI | 1S/C13H20/c1-7-13-11(5)9(3)8(2)10(4)12(13)6/h7H2,1-6H3 |
| InChIKey | PIOVGSBSKHQCIJ-UHFFFAOYSA-N |
| Density | 0.866g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.977°C at 760 mmHg (Cal.) |
| Flash point | 109.76°C (Cal.) |
| Refractive index | 1.5 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-2,3,4,5,6-Pentamethylbenzene |