|
CAS#: 23923-00-4 Product: 5,6-Dimethoxy-N-Methyl-2-Naphthalenamine No suppilers available for the product. |
| Name | 5,6-Dimethoxy-N-Methyl-2-Naphthalenamine |
|---|---|
| Synonyms | 5,6-Dimethoxy-N-Methyl-Naphthalen-1-Amine; 5,6-Dimethoxy-N-Methyl-1-Naphthalenamine; (5,6-Dimethoxy-1-Naphthyl)-Methyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 |
| CAS Registry Number | 23923-00-4 |
| SMILES | C1=CC=C(C2=C1C(=C(C=C2)OC)OC)NC |
| InChI | 1S/C13H15NO2/c1-14-11-6-4-5-10-9(11)7-8-12(15-2)13(10)16-3/h4-8,14H,1-3H3 |
| InChIKey | NBWKNHLGNFLGOW-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.696°C at 760 mmHg (Cal.) |
| Flash point | 144.212°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethoxy-N-Methyl-2-Naphthalenamine |