|
CAS#: 23926-51-4 Product: Ethyl L-Threoninate No suppilers available for the product. |
| Name | Ethyl L-Threoninate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 |
| CAS Registry Number | 23926-51-4 |
| SMILES | O=C(OCC)[C@@H](N)[C@H](O)C |
| InChI | 1S/C6H13NO3/c1-3-10-6(9)5(7)4(2)8/h4-5,8H,3,7H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | JNTDLWHHJMGLGD-UHNVWZDZSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.022°C at 760 mmHg (Cal.) |
| Flash point | 107.429°C (Cal.) |
| Refractive index | 1.462 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl L-Threoninate |