|
CAS#: 2394-04-9 Product: 1-Bromo-4-[(4-Bromophenyl)Sulfonylmethylsulfonyl]Benzene No suppilers available for the product. |
| Name | 1-Bromo-4-[(4-Bromophenyl)Sulfonylmethylsulfonyl]Benzene |
|---|---|
| Synonyms | Nsc370365 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Br2O4S2 |
| Molecular Weight | 454.15 |
| CAS Registry Number | 2394-04-9 |
| SMILES | C1=CC(=CC=C1[S](C[S](C2=CC=C(C=C2)Br)(=O)=O)(=O)=O)Br |
| InChI | 1S/C13H10Br2O4S2/c14-10-1-5-12(6-2-10)20(16,17)9-21(18,19)13-7-3-11(15)4-8-13/h1-8H,9H2 |
| InChIKey | GNLWRDUYIDEDLG-UHFFFAOYSA-N |
| Density | 1.818g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.76°C at 760 mmHg (Cal.) |
| Flash point | 325.596°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-4-[(4-Bromophenyl)Sulfonylmethylsulfonyl]Benzene |