|
CAS#: 24260-42-2 Product: Carbonic Acid 4-Formylphenyl Methyl Ester No suppilers available for the product. |
| Name | Carbonic Acid 4-Formylphenyl Methyl Ester |
|---|---|
| Synonyms | Carbonic Acid (4-Formylphenyl) Methyl Ester; (4-Methanoylphenyl) Methyl Carbonate; Carbonic Acid, 4-Formylphenyl Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 24260-42-2 |
| SMILES | C1=C(C=CC(=C1)OC(=O)OC)C=O |
| InChI | 1S/C9H8O4/c1-12-9(11)13-8-4-2-7(6-10)3-5-8/h2-6H,1H3 |
| InChIKey | GQYLKKWTYKNXIC-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.053°C at 760 mmHg (Cal.) |
| Flash point | 132.972°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbonic Acid 4-Formylphenyl Methyl Ester |