|
CAS#: 24310-43-8 Product: 3-(Chloromethyl)-6-Nitro-1,2,3-Benzotriazin-4(3H)-One No suppilers available for the product. |
| Name | 3-(Chloromethyl)-6-Nitro-1,2,3-Benzotriazin-4(3H)-One |
|---|---|
| Synonyms | 3-(Chloromethyl)-6-nitro-1,2,3-benzotriazin-4(3H)-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5ClN4O3 |
| Molecular Weight | 240.60 |
| CAS Registry Number | 24310-43-8 |
| SMILES | [O-][N+](=O)c2ccc1/N=N\N(C(=O)c1c2)CCl |
| InChI | 1S/C8H5ClN4O3/c9-4-12-8(14)6-3-5(13(15)16)1-2-7(6)10-11-12/h1-3H,4H2 |
| InChIKey | KNNURMYVQZKOGN-UHFFFAOYSA-N |
| Density | 1.762g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.049°C at 760 mmHg (Cal.) |
| Flash point | 201.791°C (Cal.) |
| Refractive index | 1.747 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Chloromethyl)-6-Nitro-1,2,3-Benzotriazin-4(3H)-One |