|
CAS#: 24342-51-6 Product: Biphenylyl-Glyoxal Diethyl Hydrazone No suppilers available for the product. |
| Name | Biphenylyl-Glyoxal Diethyl Hydrazone |
|---|---|
| Synonyms | (2E)-2-(Diethylhydrazono)-1-(4-Phenylphenyl)Ethanone; Biphenylylglyoxal N,N-Diethylhydrazone; Glyoxal, Biphenylyl-, Diethyl Hydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 |
| CAS Registry Number | 24342-51-6 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)C(=O)/C=N/N(CC)CC |
| InChI | 1S/C18H20N2O/c1-3-20(4-2)19-14-18(21)17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-14H,3-4H2,1-2H3/b19-14+ |
| InChIKey | IQRKAGUQCVXZSS-XMHGGMMESA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.217°C at 760 mmHg (Cal.) |
| Flash point | 212.174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Biphenylyl-Glyoxal Diethyl Hydrazone |