|
CAS#: 24346-19-8 Product: 4'-Chloro-alpha-(Dimethylhydrazono)Acetophenone No suppilers available for the product. |
| Name | 4'-Chloro-alpha-(Dimethylhydrazono)Acetophenone |
|---|---|
| Synonyms | (2E)-1-(4-Chlorophenyl)-2-(Dimethylhydrazono)Ethanone; Brn 2442532; Glyoxal, P-Chlorophenyl-, Dimethyl Hydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 |
| CAS Registry Number | 24346-19-8 |
| SMILES | C1=C(C(=O)/C=N/N(C)C)C=CC(=C1)Cl |
| InChI | 1S/C10H11ClN2O/c1-13(2)12-7-10(14)8-3-5-9(11)6-4-8/h3-7H,1-2H3/b12-7+ |
| InChIKey | KUZRSCRQPYFUKP-KPKJPENVSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.793°C at 760 mmHg (Cal.) |
| Flash point | 143.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Chloro-alpha-(Dimethylhydrazono)Acetophenone |