|
CAS#: 24367-94-0 Product: N-Acetyl-4,4'-Diaminodiphenylmethane No suppilers available for the product. |
| Name | N-Acetyl-4,4'-Diaminodiphenylmethane |
|---|---|
| Synonyms | N-[4-(4-Aminobenzyl)Phenyl]Acetamide; N-[4-[(4-Aminophenyl)Methyl]Phenyl]Ethanamide; N-Acetyl-4,4'-Diaminodiphenylmethane |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30 |
| CAS Registry Number | 24367-94-0 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(N)C=C2)NC(C)=O |
| InChI | 1S/C15H16N2O/c1-11(18)17-15-8-4-13(5-9-15)10-12-2-6-14(16)7-3-12/h2-9H,10,16H2,1H3,(H,17,18) |
| InChIKey | SQTDJPRWHARDHF-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.953°C at 760 mmHg (Cal.) |
| Flash point | 244.672°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-4,4'-Diaminodiphenylmethane |