Online Database of Chemicals from Around the World
| Name | 4-(3-Aminophenyl)Diazenylbenzene-1,3-Diamine |
|---|---|
| Synonyms | 4-(3-Aminophenyl)Azobenzene-1,3-Diamine; [5-Amino-2-(3-Aminophenyl)Azo-Phenyl]Amine; 1,3-Benzenediamine, 4-((3-Aminophenyl)Azo)- |
| Molecular Structure |  |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 |
| CAS Registry Number | 2437-46-9 |
| SMILES | C1=C(N)C=CC(=C1N)N=NC2=CC=CC(=C2)N |
| InChI | 1S/C12H13N5/c13-8-2-1-3-10(6-8)16-17-12-5-4-9(14)7-11(12)15/h1-7H,13-15H2 |
| InChIKey | GHXFKDSKIJTDIO-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.299°C at 760 mmHg (Cal.) |
| Flash point | 269.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Aminophenyl)Diazenylbenzene-1,3-Diamine |
