|
CAS#: 2438-88-2 Product: 1,2,4,5-Tetrachloro-3-Methoxy-6-Nitrobenzene No suppilers available for the product. |
| Name | 1,2,4,5-Tetrachloro-3-Methoxy-6-Nitrobenzene |
|---|---|
| Synonyms | 1,2,4,5-Tetrachloro-3-Methoxy-6-Nitro-Benzene; Nsc407047; 2,3,5,6-Tetrachloro-4-Nitroanisole |
| Molecular Structure | ![]() |
| Molecular Formula | C7H3Cl4NO3 |
| Molecular Weight | 290.92 |
| CAS Registry Number | 2438-88-2 |
| SMILES | COC1=C(C(=C(C(=C1Cl)Cl)[N+]([O-])=O)Cl)Cl |
| InChI | 1S/C7H3Cl4NO3/c1-15-7-4(10)2(8)6(12(13)14)3(9)5(7)11/h1H3 |
| InChIKey | BGPPUXMKKQMWLV-UHFFFAOYSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.633°C at 760 mmHg (Cal.) |
| Flash point | 174.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetrachloro-3-Methoxy-6-Nitrobenzene |