|
CAS#: 24388-85-0 Product: N-Butyl-2,2,4-Trimethyl-3-Oxopentanamide No suppilers available for the product. |
| Name | N-Butyl-2,2,4-Trimethyl-3-Oxopentanamide |
|---|---|
| Synonyms | N-Butyl-2,2,4-Trimethyl-3-Oxo-Pentanamide; N-Butyl-3-Keto-2,2,4-Trimethyl-Valeramide; N-Butyl-2,2,4-Trimethyl-3-Oxovaleramide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 |
| CAS Registry Number | 24388-85-0 |
| SMILES | C(NC(C(C(C(C)C)=O)(C)C)=O)CCC |
| InChI | 1S/C12H23NO2/c1-6-7-8-13-11(15)12(4,5)10(14)9(2)3/h9H,6-8H2,1-5H3,(H,13,15) |
| InChIKey | ZKIZNUSNNVSDMA-UHFFFAOYSA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.182°C at 760 mmHg (Cal.) |
| Flash point | 124.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Butyl-2,2,4-Trimethyl-3-Oxopentanamide |