|
CAS#: 24385-32-8 Product: 1-Methyl-1-Phenyl-N,N'-Bis(Trimethylsilyl)Silanediamine No suppilers available for the product. |
| Name | 1-Methyl-1-Phenyl-N,N'-Bis(Trimethylsilyl)Silanediamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H28N2Si3 |
| Molecular Weight | 296.63 |
| CAS Registry Number | 24385-32-8 |
| SMILES | C[Si](C)(C)N[Si](C)(N[Si](C)(C)C)c1ccccc1 |
| InChI | 1S/C13H28N2Si3/c1-16(2,3)14-18(7,15-17(4,5)6)13-11-9-8-10-12-13/h8-12,14-15H,1-7H3 |
| InChIKey | UQQFGAAFZIOZPB-UHFFFAOYSA-N |
| Density | 0.906g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.803°C at 760 mmHg (Cal.) |
| Flash point | 132.697°C (Cal.) |
| Refractive index | 1.479 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1-Phenyl-N,N'-Bis(Trimethylsilyl)Silanediamine |