|
CAS#: 24390-69-0 Product: (E)-1-(4-Methoxy-1-Naphthyl)-2-Phenyldiazene No suppilers available for the product. |
| Name | (E)-1-(4-Methoxy-1-Naphthyl)-2-Phenyldiazene |
|---|---|
| Synonyms | 1-Methoxy-4-(Phenylazo)Naphthalene; MFCD00171474 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 |
| CAS Registry Number | 24390-69-0 |
| SMILES | N(=N/c2c1ccccc1c(OC)cc2)\c3ccccc3 |
| InChI | 1S/C17H14N2O/c1-20-17-12-11-16(14-9-5-6-10-15(14)17)19-18-13-7-3-2-4-8-13/h2-12H,1H3/b19-18+ |
| InChIKey | DPJLHOWRSVQVIO-VHEBQXMUSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.549°C at 760 mmHg (Cal.) |
| Flash point | 174.821°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1-(4-Methoxy-1-Naphthyl)-2-Phenyldiazene |