|
CAS#: 24397-96-4 Product: 2-Amino-9-(2-Methylpropyl)-3H-Purine-6-Thione No suppilers available for the product. |
| Name | 2-Amino-9-(2-Methylpropyl)-3H-Purine-6-Thione |
|---|---|
| Synonyms | 2-Amino-9-Isobutyl-3H-Purine-6-Thione; 9H-Purine-6-Thiol, 2-Amino-9-Isobutyl-; Nsc42378 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 |
| CAS Registry Number | 24397-96-4 |
| SMILES | C1=NC2=C([N]1CC(C)C)NC(=NC2=S)N |
| InChI | 1S/C9H13N5S/c1-5(2)3-14-4-11-6-7(14)12-9(10)13-8(6)15/h4-5H,3H2,1-2H3,(H3,10,12,13,15) |
| InChIKey | XWBIXZMDYHIGQH-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.47°C at 760 mmHg (Cal.) |
| Flash point | 236.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-9-(2-Methylpropyl)-3H-Purine-6-Thione |