|
CAS#: 24478-01-1 Product: 2-[(4-Methylphenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2-[(4-Methylphenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2-[(4-Methylphenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine; 2-[(4-Methylphenyl)Thio]-4,6-Bis(Trichloromethyl)-S-Triazine; 1,3,5-Triazine, 2-[(4-Methylphenyl)Thio]-4,6-Bis(Trichloromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7Cl6N3S |
| Molecular Weight | 437.99 |
| CAS Registry Number | 24478-01-1 |
| SMILES | C1=CC(=CC=C1SC2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)C |
| InChI | 1S/C12H7Cl6N3S/c1-6-2-4-7(5-3-6)22-10-20-8(11(13,14)15)19-9(21-10)12(16,17)18/h2-5H,1H3 |
| InChIKey | HCXWWANCOSDRNI-UHFFFAOYSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.042°C at 760 mmHg (Cal.) |
| Flash point | 246.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Methylphenyl)Thio]-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |